CAS 2225170-53-4 appears in our catalog under these names: (2–(METHOXYCARBONYL)–6–CHLOROPYRIDIN–4–YL)BORONIC ACID, 2-Chloro-6-(methoxycarbonyl)pyridine-4-boronic acid, 97%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 25mg, 5mg, 1g, 250mg.
(2-chloro-6-methoxycarbonyl-4-pyridinyl)boronic acid (CAS 2225170-53-4) is a chemical compound with the molecular formula C7H7BClNO4 and a molecular weight of 215.40 g/mol. IUPAC name: (2-chloro-6-methoxycarbonyl-4-pyridinyl)boronic acid. InChIKey: PYPCHEPNKZCWDM-UHFFFAOYSA-N.
| Molecular formula | C7H7BClNO4 |
|---|---|
| Molecular weight | 215.40 g/mol |
| IUPAC name | (2-chloro-6-methoxycarbonyl-4-pyridinyl)boronic acid |
| InChIKey | PYPCHEPNKZCWDM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Cl)C(=O)OC)(O)O |
Computed by PubChem (NCBI)