Products 2096332-17-9

CAS 2096332-17-9 is the registry number for 2-Chloro-3-(methoxycarbonyl)pyridine-5-boronic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

(6-chloro-5-methoxycarbonyl-3-pyridinyl)boronic acid (CAS 2096332-17-9) is a chemical compound with the molecular formula C7H7BClNO4 and a molecular weight of 215.40 g/mol. IUPAC name: (6-chloro-5-methoxycarbonyl-3-pyridinyl)boronic acid. InChIKey: DIFRSSBVMUHAMI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BClNO4
Molecular weight215.40 g/mol
IUPAC name(6-chloro-5-methoxycarbonyl-3-pyridinyl)boronic acid
InChIKeyDIFRSSBVMUHAMI-UHFFFAOYSA-N
SMILESB(C1=CC(=C(N=C1)Cl)C(=O)OC)(O)O

Computed by PubChem (NCBI)