CAS 2096332-17-9 is the registry number for 2-Chloro-3-(methoxycarbonyl)pyridine-5-boronic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(6-chloro-5-methoxycarbonyl-3-pyridinyl)boronic acid (CAS 2096332-17-9) is a chemical compound with the molecular formula C7H7BClNO4 and a molecular weight of 215.40 g/mol. IUPAC name: (6-chloro-5-methoxycarbonyl-3-pyridinyl)boronic acid. InChIKey: DIFRSSBVMUHAMI-UHFFFAOYSA-N.
| Molecular formula | C7H7BClNO4 |
|---|---|
| Molecular weight | 215.40 g/mol |
| IUPAC name | (6-chloro-5-methoxycarbonyl-3-pyridinyl)boronic acid |
| InChIKey | DIFRSSBVMUHAMI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)Cl)C(=O)OC)(O)O |
Computed by PubChem (NCBI)