CAS 1217501-53-5 is the registry number for (2-Methyl-4-(morpholinosulfonyl)phenyl)boronic acid, 96%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
(2-methyl-4-morpholin-4-ylsulfonylphenyl)boronic acid (CAS 1217501-53-5) is a chemical compound with the molecular formula C11H16BNO5S and a molecular weight of 285.13 g/mol. IUPAC name: (2-methyl-4-morpholin-4-ylsulfonylphenyl)boronic acid. InChIKey: NHJXSFKMSZWBNM-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO5S |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | (2-methyl-4-morpholin-4-ylsulfonylphenyl)boronic acid |
| InChIKey | NHJXSFKMSZWBNM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)N2CCOCC2)C)(O)O |
Computed by PubChem (NCBI)