CAS 957120-81-9 appears in our catalog under these names: 4-(N-(3-Methylbutanoyl)sulfamoyl)phenylboronic acid, 98%, (4-(N-(3-Methylbutanoyl)sulfamoyl)phenyl)boronic acid, 98% ,, 98% ,, (4-(N-(3-Methylbutanoyl)sulfamoyl)phenyl)-boronic acid, 95%, (4-(N-(3-Methylbutanoyl)sulfamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
[4-(3-methylbutanoylsulfamoyl)phenyl]boronic acid (CAS 957120-81-9) is a chemical compound with the molecular formula C11H16BNO5S and a molecular weight of 285.13 g/mol. IUPAC name: [4-(3-methylbutanoylsulfamoyl)phenyl]boronic acid. InChIKey: IVLBTLHEFYQBJN-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO5S |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | [4-(3-methylbutanoylsulfamoyl)phenyl]boronic acid |
| InChIKey | IVLBTLHEFYQBJN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC(=O)CC(C)C)(O)O |
Computed by PubChem (NCBI)