CAS 1704065-60-0 is the registry number for 4–Methyl–3–(morpholinosulfonyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 1g.
(4-methyl-3-morpholin-4-ylsulfonylphenyl)boronic acid (CAS 1704065-60-0) is a chemical compound with the molecular formula C11H16BNO5S and a molecular weight of 285.13 g/mol. IUPAC name: (4-methyl-3-morpholin-4-ylsulfonylphenyl)boronic acid. InChIKey: WMDBVOKHZSYLFD-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO5S |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | (4-methyl-3-morpholin-4-ylsulfonylphenyl)boronic acid |
| InChIKey | WMDBVOKHZSYLFD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)S(=O)(=O)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)