CAS 1217601-63-2 is the registry number for (R)-2-Amino-3-(2,4,5-trifluorophenyl)propanoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
(2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoic acid (CAS 1217601-63-2) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoic acid. InChIKey: SWJFYJHCOWRRLR-MRVPVSSYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoic acid |
| InChIKey | SWJFYJHCOWRRLR-MRVPVSSYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)