CAS 1217624-82-2 is the registry number for N-Boc-4-fluoro-(R)-homophenylalanine, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(2R)-4-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1217624-82-2) is a chemical compound with the molecular formula C15H20FNO4 and a molecular weight of 297.32 g/mol. IUPAC name: (2R)-4-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: JYPLRFOLNJICIF-GFCCVEGCSA-N.
| Molecular formula | C15H20FNO4 |
|---|---|
| Molecular weight | 297.32 g/mol |
| IUPAC name | (2R)-4-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | JYPLRFOLNJICIF-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)