CAS 1217754-68-1 is the registry number for Boc-alpha-methyl-l-4-fluorophe, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2S)-3-(4-fluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1217754-68-1) is a chemical compound with the molecular formula C15H20FNO4 and a molecular weight of 297.32 g/mol. IUPAC name: (2S)-3-(4-fluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: FYZOMAOEKLIUIA-HNNXBMFYSA-N.
| Molecular formula | C15H20FNO4 |
|---|---|
| Molecular weight | 297.32 g/mol |
| IUPAC name | (2S)-3-(4-fluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | FYZOMAOEKLIUIA-HNNXBMFYSA-N |
| SMILES | C[C@](CC1=CC=C(C=C1)F)(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)