CAS 134362-34-8 is the registry number for (S)-2-tert-Butoxycarbonylamino-3-(4-fluoro-phenyl)-propionic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 134362-34-8) is a chemical compound with the molecular formula C15H20FNO4 and a molecular weight of 297.32 g/mol. IUPAC name: methyl (2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: CSKFYKNIJQMDLZ-LBPRGKRZSA-N.
| Molecular formula | C15H20FNO4 |
|---|---|
| Molecular weight | 297.32 g/mol |
| IUPAC name | methyl (2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | CSKFYKNIJQMDLZ-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)F)C(=O)OC |
Computed by PubChem (NCBI)