Products 1217625-71-2
CAS 1217625-71-2 appears in our catalog under these names: Mecamylamine-d3 Hydrochloride, Mecamylamine-d3 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
(1S,2R,4R)-2,3,3-trimethyl-N-(trideuteriomethyl)bicyclo[2.2.1]heptan-2-amine;hydrochloride (CAS 1217625-71-2) is a chemical compound with the molecular formula C11H22ClN and a molecular weight of 206.77 g/mol. IUPAC name: (1S,2R,4R)-2,3,3-trimethyl-N-(trideuteriomethyl)bicyclo[2.2.1]heptan-2-amine;hydrochloride. InChIKey: PKVZBNCYEICAQP-HUGYAVALSA-N.
| Molecular formula | C11H22ClN |
|---|---|
| Molecular weight | 206.77 g/mol |
| IUPAC name | (1S,2R,4R)-2,3,3-trimethyl-N-(trideuteriomethyl)bicyclo[2.2.1]heptan-2-amine;hydrochloride |
| InChIKey | PKVZBNCYEICAQP-HUGYAVALSA-N |
| SMILES | [2H]C([2H])([2H])N[C@@]1([C@H]2CC[C@H](C2)C1(C)C)C.Cl |
Computed by PubChem (NCBI)
Synonyms:
Mecamylamine-d3 Hydrochloride, Inversine-d3