CAS 1909309-37-0 appears in our catalog under these names: 3-tert-Butyl-N-cyclopropylcyclobutan-1-amine hydrochloride, 95%, 3-tert-Butyl-N-cyclopropylcyclobutan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-tert-butyl-N-cyclopropylcyclobutan-1-amine;hydrochloride (CAS 1909309-37-0) is a chemical compound with the molecular formula C11H22ClN and a molecular weight of 203.75 g/mol. IUPAC name: 3-tert-butyl-N-cyclopropylcyclobutan-1-amine;hydrochloride. InChIKey: HZOMVHOFHSYVBN-UHFFFAOYSA-N.
| Molecular formula | C11H22ClN |
|---|---|
| Molecular weight | 203.75 g/mol |
| IUPAC name | 3-tert-butyl-N-cyclopropylcyclobutan-1-amine;hydrochloride |
| InChIKey | HZOMVHOFHSYVBN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CC(C1)NC2CC2.Cl |
Computed by PubChem (NCBI)