CAS 1217627-86-5 is the registry number for Fmoc–2,4–Dimethyl–D–phenylalanine. Offered by: GLPBio. Available pack sizes: 1g.
(2R)-3-(2,4-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1217627-86-5) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: (2R)-3-(2,4-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: MXBSNHLSKRVUBF-XMMPIXPASA-N.
| Molecular formula | C26H25NO4 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2R)-3-(2,4-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | MXBSNHLSKRVUBF-XMMPIXPASA-N |
| SMILES | CC1=CC(=C(C=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)