Products 1217632-04-6
CAS 1217632-04-6 appears in our catalog under these names: D-Neopterin-13C5, Neopterin-13C5, D-Neopterin-13C5, >95% (HPLC), Neopterin–13C5, Neopterin-13C5, 97.53%. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,5mg.
2-amino-6-[(1S,2R)-1,2,3-trihydroxy(1,2,3-13C3)propyl]-3H-pteridin-4-one (CAS 1217632-04-6) is a chemical compound with the molecular formula C9H11N5O4 and a molecular weight of 258.18 g/mol. IUPAC name: 2-amino-6-[(1S,2R)-1,2,3-trihydroxy(1,2,3-13C3)propyl]-3H-pteridin-4-one. InChIKey: BMQYVXCPAOLZOK-NNFFBITRSA-N.
| Molecular formula | C9H11N5O4 |
|---|---|
| Molecular weight | 258.18 g/mol |
| IUPAC name | 2-amino-6-[(1S,2R)-1,2,3-trihydroxy(1,2,3-13C3)propyl]-3H-pteridin-4-one |
| InChIKey | BMQYVXCPAOLZOK-NNFFBITRSA-N |
| SMILES | [13CH]1=[13C](N=C2C(=O)NC(=NC2=N1)N)[13C@@H]([13C@@H]([13CH2]O)O)O |
Computed by PubChem (NCBI)