CAS 35959-37-6 appears in our catalog under these names: 5’-Azido-2’,5’-dideoxyuridine, 5’-Azido-2’,5’-dideoxyuridine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 50mg, 25mg, Get quote.
1-[(2R,4S,5R)-5-(azidomethyl)-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (CAS 35959-37-6) is a chemical compound with the molecular formula C9H11N5O4 and a molecular weight of 253.22 g/mol. IUPAC name: 1-[(2R,4S,5R)-5-(azidomethyl)-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione. InChIKey: VAGBIQTXMSHWJX-SHYZEUOFSA-N.
| Molecular formula | C9H11N5O4 |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-5-(azidomethyl)-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | VAGBIQTXMSHWJX-SHYZEUOFSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)CN=[N+]=[N-])O |
Computed by PubChem (NCBI)