CAS 145514-01-8 is the registry number for 2-Amino-9-((2R,4R)-2-(hydroxymethyl)-1,3-dioxolan-4-yl)-1H-purin-6(9H)-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-9-[(2R,4R)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-1H-purin-6-one (CAS 145514-01-8) is a chemical compound with the molecular formula C9H11N5O4 and a molecular weight of 253.22 g/mol. IUPAC name: 2-amino-9-[(2R,4R)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-1H-purin-6-one. InChIKey: DXNPMWVLIOKPNO-RFZPGFLSSA-N.
| Molecular formula | C9H11N5O4 |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 2-amino-9-[(2R,4R)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-1H-purin-6-one |
| InChIKey | DXNPMWVLIOKPNO-RFZPGFLSSA-N |
| SMILES | C1[C@@H](O[C@@H](O1)CO)N2C=NC3=C2N=C(NC3=O)N |
Computed by PubChem (NCBI)