CAS 1217656-59-1 appears in our catalog under these names: R-3-Boc-aminopiperidine hydrochloride, 96%, (R)-tert-Butyl piperidin-3-ylcarbamate hydrochloride, 97%, (R)–tert–Butyl piperidin–3–ylcarbamate hydrochloride, (R)-tert-Butyl piperidin-3-ylcarbamate hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 0,25g, 2,5g, 10g.
Tert-butyl N-[(3R)-piperidin-3-yl]carbamate;hydrochloride (CAS 1217656-59-1) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(3R)-piperidin-3-yl]carbamate;hydrochloride. InChIKey: FQJZJMFUNRMGTA-DDWIOCJRSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[(3R)-piperidin-3-yl]carbamate;hydrochloride |
| InChIKey | FQJZJMFUNRMGTA-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCNC1.Cl |
Computed by PubChem (NCBI)