CAS 1217684-62-2 is the registry number for D-(3,4,5-Trifluorophenyl)-alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2R)-2-amino-3-(3,4,5-trifluorophenyl)propanoic acid (CAS 1217684-62-2) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: (2R)-2-amino-3-(3,4,5-trifluorophenyl)propanoic acid. InChIKey: SFKCVRLOYOHGFK-SSDOTTSWSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | (2R)-2-amino-3-(3,4,5-trifluorophenyl)propanoic acid |
| InChIKey | SFKCVRLOYOHGFK-SSDOTTSWSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)