CAS 1217686-14-0 appears in our catalog under these names: 4’-Hydroxy Atomoxetine-d3, >95% (HPLC), 4-Hydroxyatomoxetine D3, 4–Hydroxyatomoxetine–d3, 4’-Hydroxy atomoxetine-d3, 4-Hydroxyatomoxetine-d3, 98.89%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 5 mg, 1 mg.
3-methyl-4-[(1R)-1-phenyl-3-(trideuteriomethylamino)propoxy]phenol (CAS 1217686-14-0) is a chemical compound with the molecular formula C17H21NO2 and a molecular weight of 274.37 g/mol. IUPAC name: 3-methyl-4-[(1R)-1-phenyl-3-(trideuteriomethylamino)propoxy]phenol. InChIKey: PPXQPRLGNSJNJM-NVNSKBCASA-N.
| Molecular formula | C17H21NO2 |
|---|---|
| Molecular weight | 274.37 g/mol |
| IUPAC name | 3-methyl-4-[(1R)-1-phenyl-3-(trideuteriomethylamino)propoxy]phenol |
| InChIKey | PPXQPRLGNSJNJM-NVNSKBCASA-N |
| SMILES | [2H]C([2H])([2H])NCC[C@H](C1=CC=CC=C1)OC2=C(C=C(C=C2)O)C |
Computed by PubChem (NCBI)