CAS 1797024-36-2 is the registry number for 4-Hydroxy Atomoxetine (S-Isomer). Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-4-[(1S)-3-(methylamino)-1-phenylpropoxy]phenol (CAS 1797024-36-2) is a chemical compound with the molecular formula C17H21NO2 and a molecular weight of 271.35 g/mol. IUPAC name: 3-methyl-4-[(1S)-3-(methylamino)-1-phenylpropoxy]phenol. InChIKey: PPXQPRLGNSJNJM-KRWDZBQOSA-N.
| Molecular formula | C17H21NO2 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 3-methyl-4-[(1S)-3-(methylamino)-1-phenylpropoxy]phenol |
| InChIKey | PPXQPRLGNSJNJM-KRWDZBQOSA-N |
| SMILES | CC1=C(C=CC(=C1)O)O[C@@H](CCNC)C2=CC=CC=C2 |
Computed by PubChem (NCBI)