CAS 1217692-15-3 is the registry number for S-(-)-Cotinine Perchlorate, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5g, 250mg.
(5S)-1-methyl-5-pyridin-3-ylpyrrolidin-2-one;perchloric acid (CAS 1217692-15-3) is a chemical compound with the molecular formula C10H13ClN2O5 and a molecular weight of 276.67 g/mol. IUPAC name: (5S)-1-methyl-5-pyridin-3-ylpyrrolidin-2-one;perchloric acid. InChIKey: BCPGJSNBNYRZDX-FVGYRXGTSA-N.
| Molecular formula | C10H13ClN2O5 |
|---|---|
| Molecular weight | 276.67 g/mol |
| IUPAC name | (5S)-1-methyl-5-pyridin-3-ylpyrrolidin-2-one;perchloric acid |
| InChIKey | BCPGJSNBNYRZDX-FVGYRXGTSA-N |
| SMILES | CN1[C@@H](CCC1=O)C2=CN=CC=C2.OCl(=O)(=O)=O |
Computed by PubChem (NCBI)