Products 54898-34-9
CAS 54898-34-9 is the registry number for 2’-Chlorothymidine. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg.
1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 54898-34-9) is a chemical compound with the molecular formula C10H13ClN2O5 and a molecular weight of 276.67 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: WQMQACLYZYXSDZ-JXOAFFINSA-N.
| Molecular formula | C10H13ClN2O5 |
|---|---|
| Molecular weight | 276.67 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | WQMQACLYZYXSDZ-JXOAFFINSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)Cl |
Computed by PubChem (NCBI)