Products 2940959-71-5
CAS 2940959-71-5 is the registry number for methyl 2-(2-aminoethoxy)-4-nitro-benzoate,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Methyl 2-(2-aminoethoxy)-4-nitrobenzoate;hydrochloride (CAS 2940959-71-5) is a chemical compound with the molecular formula C10H13ClN2O5 and a molecular weight of 276.67 g/mol. IUPAC name: methyl 2-(2-aminoethoxy)-4-nitrobenzoate;hydrochloride. InChIKey: LILSRQBHPRYOFK-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O5 |
|---|---|
| Molecular weight | 276.67 g/mol |
| IUPAC name | methyl 2-(2-aminoethoxy)-4-nitrobenzoate;hydrochloride |
| InChIKey | LILSRQBHPRYOFK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])OCCN.Cl |
Computed by PubChem (NCBI)