CAS 1217705-21-9 appears in our catalog under these names: Seligiline Hydrochloride d5, Selegiline-d5 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, Get quote.
(2R)-N-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynylpropan-2-amine;hydrochloride (CAS 1217705-21-9) is a chemical compound with the molecular formula C13H18ClN and a molecular weight of 228.77 g/mol. IUPAC name: (2R)-N-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynylpropan-2-amine;hydrochloride. InChIKey: IYETZZCWLLUHIJ-AAQPRKMGSA-N.
| Molecular formula | C13H18ClN |
|---|---|
| Molecular weight | 228.77 g/mol |
| IUPAC name | (2R)-N-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynylpropan-2-amine;hydrochloride |
| InChIKey | IYETZZCWLLUHIJ-AAQPRKMGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C)N(C)CC#C)[2H])[2H].Cl |
Computed by PubChem (NCBI)