CAS 1795787-02-8 is the registry number for S-(+)-Deprenyl-d3 hydrochloride. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
(2S)-1-phenyl-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine;hydrochloride (CAS 1795787-02-8) is a chemical compound with the molecular formula C13H18ClN and a molecular weight of 226.76 g/mol. IUPAC name: (2S)-1-phenyl-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine;hydrochloride. InChIKey: IYETZZCWLLUHIJ-GYLNYKGVSA-N.
| Molecular formula | C13H18ClN |
|---|---|
| Molecular weight | 226.76 g/mol |
| IUPAC name | (2S)-1-phenyl-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine;hydrochloride |
| InChIKey | IYETZZCWLLUHIJ-GYLNYKGVSA-N |
| SMILES | [2H]C([2H])([2H])N(CC#C)[C@@H](C)CC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)