CAS 4528-52-3 appears in our catalog under these names: Selegiline EP Impurity E HCl (D-Deprenyl HCl), S-(+)-Deprenyl Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
(2S)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine;hydrochloride (CAS 4528-52-3) is a chemical compound with the molecular formula C13H18ClN and a molecular weight of 223.74 g/mol. IUPAC name: (2S)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine;hydrochloride. InChIKey: IYETZZCWLLUHIJ-YDALLXLXSA-N.
| Molecular formula | C13H18ClN |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | (2S)-N-methyl-1-phenyl-N-prop-2-ynylpropan-2-amine;hydrochloride |
| InChIKey | IYETZZCWLLUHIJ-YDALLXLXSA-N |
| SMILES | C[C@@H](CC1=CC=CC=C1)N(C)CC#C.Cl |
Computed by PubChem (NCBI)