CAS 1217753-37-1 appears in our catalog under these names: (R)–Benzyl 3–benzylpiperazine–1–carboxylate hydrochloride, (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride, 95%, (R)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Benzyl (3R)-3-benzylpiperazine-1-carboxylate;hydrochloride (CAS 1217753-37-1) is a chemical compound with the molecular formula C19H23ClN2O2 and a molecular weight of 346.8 g/mol. IUPAC name: benzyl (3R)-3-benzylpiperazine-1-carboxylate;hydrochloride. InChIKey: KQHBPBYETAJYMS-GMUIIQOCSA-N.
| Molecular formula | C19H23ClN2O2 |
|---|---|
| Molecular weight | 346.8 g/mol |
| IUPAC name | benzyl (3R)-3-benzylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | KQHBPBYETAJYMS-GMUIIQOCSA-N |
| SMILES | C1CN(C[C@H](N1)CC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)