CAS 321660-77-9 appears in our catalog under these names: Fmoc-dab Hydrochloride, (9H–Fluoren–9–yl)methyl (4–aminobutyl)carbamate hydrochloride, Fmoc-DAB*HCl, Fmoc-1,4-diaminobutane hydrochloride, Fmoc-NH(CH2)4NH2·HCl 95%. Offered by: TRC, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 5g, 25g, 10g, 100g, 100mg, 100 mg.
9H-fluoren-9-ylmethyl N-(4-aminobutyl)carbamate;hydrochloride (CAS 321660-77-9) is a chemical compound with the molecular formula C19H23ClN2O2 and a molecular weight of 346.8 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(4-aminobutyl)carbamate;hydrochloride. InChIKey: JHRHSAILHBJRLU-UHFFFAOYSA-N.
| Molecular formula | C19H23ClN2O2 |
|---|---|
| Molecular weight | 346.8 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(4-aminobutyl)carbamate;hydrochloride |
| InChIKey | JHRHSAILHBJRLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCN.Cl |
Computed by PubChem (NCBI)