CAS 1217779-31-1 appears in our catalog under these names: (S)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride, 95%, (S)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride, 97+%, (S)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride, 95%, 95%, (S)-Benzyl 3-benzylpiperazine-1-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Benzyl (3S)-3-benzylpiperazine-1-carboxylate;hydrochloride (CAS 1217779-31-1) is a chemical compound with the molecular formula C19H23ClN2O2 and a molecular weight of 346.8 g/mol. IUPAC name: benzyl (3S)-3-benzylpiperazine-1-carboxylate;hydrochloride. InChIKey: KQHBPBYETAJYMS-FERBBOLQSA-N.
| Molecular formula | C19H23ClN2O2 |
|---|---|
| Molecular weight | 346.8 g/mol |
| IUPAC name | benzyl (3S)-3-benzylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | KQHBPBYETAJYMS-FERBBOLQSA-N |
| SMILES | C1CN(C[C@@H](N1)CC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)