CAS 218608-99-2 appears in our catalog under these names: Boc–2–fluoro–L–beta–homophenylalanine, Boc-2-fluoro-L-b-homophenylalanine, 98%, Boc-(s)-3-amino-4-(2-fluoro-phenyl)-butyric acid, 95%, Boc-(S)-3-Amino-4-(2-fluoro-phenyl)-butyric acid, 98%, 98%. Offered by: GLPBio, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
(3S)-4-(2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 218608-99-2) is a chemical compound with the molecular formula C15H20FNO4 and a molecular weight of 297.32 g/mol. IUPAC name: (3S)-4-(2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PUMMDCKRQRQFAD-NSHDSACASA-N.
| Molecular formula | C15H20FNO4 |
|---|---|
| Molecular weight | 297.32 g/mol |
| IUPAC name | (3S)-4-(2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PUMMDCKRQRQFAD-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1F)CC(=O)O |
Computed by PubChem (NCBI)