CAS 1217777-38-2 is the registry number for Cyclo(D-tyrosylglycine). Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-3-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione (CAS 1217777-38-2) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: (3R)-3-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione. InChIKey: QHLSAVHDWSYPEP-SECBINFHSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (3R)-3-[(4-hydroxyphenyl)methyl]piperazine-2,5-dione |
| InChIKey | QHLSAVHDWSYPEP-SECBINFHSA-N |
| SMILES | C1C(=O)N[C@@H](C(=O)N1)CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)