CAS 222306-15-2 appears in our catalog under these names: Pitavastatin Impurity 25 (5-Oxo Pitavastatin), Pitavastatin Impurity 53, Pitavastatin 5-oxo Impurity, Pitavastatin Impurity 7, 5-Oxo Pitavastatin, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 250mg.
(E,3R)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3-hydroxy-5-oxohept-6-enoic acid (CAS 222306-15-2) is a chemical compound with the molecular formula C25H22FNO4 and a molecular weight of 419.4 g/mol. IUPAC name: (E,3R)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3-hydroxy-5-oxohept-6-enoic acid. InChIKey: GSCOCVOFYBEZGB-TZZQJPOUSA-N.
| Molecular formula | C25H22FNO4 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (E,3R)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3-hydroxy-5-oxohept-6-enoic acid |
| InChIKey | GSCOCVOFYBEZGB-TZZQJPOUSA-N |
| SMILES | C1CC1C2=NC3=CC=CC=C3C(=C2/C=C/C(=O)C[C@H](CC(=O)O)O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)