CAS 1217813-19-8 is the registry number for (R)-3-Azido-1-phenyl-1-(2-methylphenoxy)propane. Offered by: Biosynth. Available pack sizes: 500mg.
1-[(1R)-3-azido-1-phenylpropoxy]-2-methylbenzene (CAS 1217813-19-8) is a chemical compound with the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. IUPAC name: 1-[(1R)-3-azido-1-phenylpropoxy]-2-methylbenzene. InChIKey: SPJNLNFZPWFKNL-MRXNPFEDSA-N.
| Molecular formula | C16H17N3O |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | 1-[(1R)-3-azido-1-phenylpropoxy]-2-methylbenzene |
| InChIKey | SPJNLNFZPWFKNL-MRXNPFEDSA-N |
| SMILES | CC1=CC=CC=C1O[C@H](CCN=[N+]=[N-])C2=CC=CC=C2 |
Computed by PubChem (NCBI)