CAS 2889-26-1 appears in our catalog under these names: Methylergometrine EP impurity E, D-Isolysergic Acid Amide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 50mg, 5mg, 10mg, 1mg, 2mg, 25mg.
(6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CAS 2889-26-1) is a chemical compound with the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. IUPAC name: (6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide. InChIKey: GENAHGKEFJLNJB-IINYFYTJSA-N.
| Molecular formula | C16H17N3O |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | (6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | GENAHGKEFJLNJB-IINYFYTJSA-N |
| SMILES | CN1C[C@H](C=C2[C@H]1CC3=CNC4=CC=CC2=C34)C(=O)N |
Computed by PubChem (NCBI)