CAS 1878644-68-8 is the registry number for 5-Amino-n-benzyl-2,3-dihydro-1h-indole-1-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-amino-N-benzyl-2,3-dihydroindole-1-carboxamide (CAS 1878644-68-8) is a chemical compound with the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. IUPAC name: 5-amino-N-benzyl-2,3-dihydroindole-1-carboxamide. InChIKey: DNWLMRHLXBCKPU-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | 5-amino-N-benzyl-2,3-dihydroindole-1-carboxamide |
| InChIKey | DNWLMRHLXBCKPU-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=C(C=C2)N)C(=O)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)