CAS 1217825-86-9 is the registry number for [(3S,4R)-4-(3-Methylphenyl)pyrrolidin-3-yl]methanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[(3S,4R)-4-(3-methylphenyl)pyrrolidin-3-yl]methanol;hydrochloride (CAS 1217825-86-9) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: [(3S,4R)-4-(3-methylphenyl)pyrrolidin-3-yl]methanol;hydrochloride. InChIKey: GLWXWODOLWTAAM-FXMYHANSSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | [(3S,4R)-4-(3-methylphenyl)pyrrolidin-3-yl]methanol;hydrochloride |
| InChIKey | GLWXWODOLWTAAM-FXMYHANSSA-N |
| SMILES | CC1=CC(=CC=C1)[C@@H]2CNC[C@H]2CO.Cl |
Computed by PubChem (NCBI)