CAS 1217827-64-9 appears in our catalog under these names: Boc-S-AMBA-OH, (S)-2-(((tert-Butoxycarbonyl)amino)methyl)butanoic acid, 97%, (S)-2-(tert-Butoxycarbonylamino-methyl)-butyric acid. Offered by: Creative Peptides, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
(2S)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid (CAS 1217827-64-9) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (2S)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid. InChIKey: NEIGWFMADWPGEL-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (2S)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoic acid |
| InChIKey | NEIGWFMADWPGEL-ZETCQYMHSA-N |
| SMILES | CC[C@@H](CNC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)