CAS 1217831-52-1 appears in our catalog under these names: (R)–Benzyl 3–methylpiperazine–1–carboxylate hydrochloride, (R)-Benzyl 3-methylpiperazine-1-carboxylate hydrochloride, 95%, 95%, (R)-Benzyl 3-methylpiperazine-1-carboxylate hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g.
Benzyl (3R)-3-methylpiperazine-1-carboxylate;hydrochloride (CAS 1217831-52-1) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (3R)-3-methylpiperazine-1-carboxylate;hydrochloride. InChIKey: LDHODTYPYWKFPS-RFVHGSKJSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl (3R)-3-methylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | LDHODTYPYWKFPS-RFVHGSKJSA-N |
| SMILES | C[C@@H]1CN(CCN1)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)