CAS 1217834-81-5 is the registry number for (1R,5R,6R)-rel-5-(1-Ethylpropoxy)-7-oxabicyclo(4.1.0)hept-3-ene-3-carboxylic Acid Ethyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 250mg, 25mg.
Ethyl (1R,5S,6R)-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate (CAS 1217834-81-5) is a chemical compound with the molecular formula C14H22O4 and a molecular weight of 254.32 g/mol. IUPAC name: ethyl (1R,5S,6R)-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate. InChIKey: XZXCGRFGEVXWIT-XQQFMLRXSA-N.
| Molecular formula | C14H22O4 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | ethyl (1R,5S,6R)-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate |
| InChIKey | XZXCGRFGEVXWIT-XQQFMLRXSA-N |
| SMILES | CCC(CC)O[C@H]1C=C(C[C@@H]2[C@H]1O2)C(=O)OCC |
Computed by PubChem (NCBI)