CAS 1217899-51-8 appears in our catalog under these names: Vanillylamine-d3 Hydrochloride, Vanillylamine-d3 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-(aminomethyl)-2-(trideuteriomethoxy)phenol;hydrochloride (CAS 1217899-51-8) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 192.66 g/mol. IUPAC name: 4-(aminomethyl)-2-(trideuteriomethoxy)phenol;hydrochloride. InChIKey: PUDMGOSXPCMUJZ-NIIDSAIPSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 192.66 g/mol |
| IUPAC name | 4-(aminomethyl)-2-(trideuteriomethoxy)phenol;hydrochloride |
| InChIKey | PUDMGOSXPCMUJZ-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)CN)O.Cl |
Computed by PubChem (NCBI)