CAS 1217977-04-2 appears in our catalog under these names: R-(-)-N-Demethyl Deprenyl-d5, N-Desmethyl selegiline-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
(2R)-1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynylpropan-2-amine (CAS 1217977-04-2) is a chemical compound with the molecular formula C12H15N and a molecular weight of 178.28 g/mol. IUPAC name: (2R)-1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynylpropan-2-amine. InChIKey: UUFAJPMQSFXDFR-IYMQPUKBSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 178.28 g/mol |
| IUPAC name | (2R)-1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynylpropan-2-amine |
| InChIKey | UUFAJPMQSFXDFR-IYMQPUKBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C)NCC#C)[2H])[2H] |
Computed by PubChem (NCBI)