CAS 1218-85-5 is the registry number for 2-Hydroxy-1,2-di-m-tolylethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-1,2-bis(3-methylphenyl)ethanone (CAS 1218-85-5) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 2-hydroxy-1,2-bis(3-methylphenyl)ethanone. InChIKey: BXSJLLLBDMWLJU-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 2-hydroxy-1,2-bis(3-methylphenyl)ethanone |
| InChIKey | BXSJLLLBDMWLJU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(C(=O)C2=CC=CC(=C2)C)O |
Computed by PubChem (NCBI)