Products 1218179-30-6
CAS 1218179-30-6 is the registry number for 2-{Bicyclo(2.2.1)heptane-2-amido}-5-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(bicyclo[2.2.1]heptane-2-carbonylamino)-5-methylbenzoic acid (CAS 1218179-30-6) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: 2-(bicyclo[2.2.1]heptane-2-carbonylamino)-5-methylbenzoic acid. InChIKey: FVJCXKNWBYJBCE-UHFFFAOYSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 2-(bicyclo[2.2.1]heptane-2-carbonylamino)-5-methylbenzoic acid |
| InChIKey | FVJCXKNWBYJBCE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2CC3CCC2C3)C(=O)O |
Computed by PubChem (NCBI)