Products 121825-54-5
CAS 121825-54-5 is the registry number for Gerontoxanthone C. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg.
4,8,9-trihydroxy-2,3,3-trimethyl-11-(3-methylbut-2-enyl)-2H-furo[3,2-b]xanthen-5-one (CAS 121825-54-5) is a chemical compound with the molecular formula C23H24O6 and a molecular weight of 396.4 g/mol. IUPAC name: 4,8,9-trihydroxy-2,3,3-trimethyl-11-(3-methylbut-2-enyl)-2H-furo[3,2-b]xanthen-5-one. InChIKey: MPGIKBDCZHZTJM-UHFFFAOYSA-N.
| Molecular formula | C23H24O6 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 4,8,9-trihydroxy-2,3,3-trimethyl-11-(3-methylbut-2-enyl)-2H-furo[3,2-b]xanthen-5-one |
| InChIKey | MPGIKBDCZHZTJM-UHFFFAOYSA-N |
| SMILES | CC1C(C2=C(O1)C(=C3C(=C2O)C(=O)C4=C(O3)C(=C(C=C4)O)O)CC=C(C)C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Gerontoxanthone C, GerontoxanthoneC