Products 135541-40-1
CAS 135541-40-1 is the registry number for Cudraxanthone L. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
1,3,6,7-tetrahydroxy-2-(2-methylbut-3-en-2-yl)-5-(3-methylbut-2-enyl)xanthen-9-one (CAS 135541-40-1) is a chemical compound with the molecular formula C23H24O6 and a molecular weight of 396.4 g/mol. IUPAC name: 1,3,6,7-tetrahydroxy-2-(2-methylbut-3-en-2-yl)-5-(3-methylbut-2-enyl)xanthen-9-one. InChIKey: LVKPSBFBKBJJOB-UHFFFAOYSA-N.
| Molecular formula | C23H24O6 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 1,3,6,7-tetrahydroxy-2-(2-methylbut-3-en-2-yl)-5-(3-methylbut-2-enyl)xanthen-9-one |
| InChIKey | LVKPSBFBKBJJOB-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=CC(=C1O)O)C(=O)C3=C(O2)C=C(C(=C3O)C(C)(C)C=C)O)C |
Computed by PubChem (NCBI)
Synonyms:
cudraxanthone L, orb1682878