CAS 160096-59-3 appears in our catalog under these names: Dimethoxy Curcumin, Dimethoxycurcumin/ 96.05% (existing batch purity), Dimethoxycurcumin, Dimethoxycurcumin 99%, Dimethoxycurcumin, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 10mM (in 1ml dmso), 5 mg.
(1E,6E)-1,7-bis(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione (CAS 160096-59-3) is a chemical compound with the molecular formula C23H24O6 and a molecular weight of 396.4 g/mol. IUPAC name: (1E,6E)-1,7-bis(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione. InChIKey: HMJSBVCDPKODEX-NXZHAISVSA-N.
| Molecular formula | C23H24O6 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (1E,6E)-1,7-bis(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione |
| InChIKey | HMJSBVCDPKODEX-NXZHAISVSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)CC(=O)/C=C/C2=CC(=C(C=C2)OC)OC)OC |
Computed by PubChem (NCBI)