Products 1218590-70-5

CAS 1218590-70-5 is the registry number for 3,3-Dimethyl-2-(tetrahydro-2H-pyran-4-carboxamido)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3,3-dimethyl-2-(oxane-4-carbonylamino)butanoic acid (CAS 1218590-70-5) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 3,3-dimethyl-2-(oxane-4-carbonylamino)butanoic acid. InChIKey: XLCSUFZYBLABPT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO4
Molecular weight243.30 g/mol
IUPAC name3,3-dimethyl-2-(oxane-4-carbonylamino)butanoic acid
InChIKeyXLCSUFZYBLABPT-UHFFFAOYSA-N
SMILESCC(C)(C)C(C(=O)O)NC(=O)C1CCOCC1

Computed by PubChem (NCBI)