CAS 1218777-13-9 appears in our catalog under these names: CAY10505, CAY10505/ 99.74% (existing batch purity), (E)-5-((5-(4-Fluorophenyl)furan-2-yl)methylene)thiazolidine-2,4-dione, 97%, 97%, CAY10505, 99.75%, CAY10505, 99%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Ambeed. Available pack sizes: 10mg, 200mg, 25mg, 10mM (in 1ml dmso), 50mg, 100mg, 500mg, 10mM/1mL.
(5E)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (CAS 1218777-13-9) is a chemical compound with the molecular formula C14H8FNO3S and a molecular weight of 289.28 g/mol. IUPAC name: (5E)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: UFBTYTGRUBUUIL-KPKJPENVSA-N.
| Molecular formula | C14H8FNO3S |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | (5E)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | UFBTYTGRUBUUIL-KPKJPENVSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)/C=C/3\C(=O)NC(=O)S3)F |
Computed by PubChem (NCBI)