CAS 1809143-43-8 is the registry number for 4-Fluoro-11-oxo-10,11-dihydrodibenzo[b,f][1,4]thiazepine-8-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
10-fluoro-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylic acid (CAS 1809143-43-8) is a chemical compound with the molecular formula C14H8FNO3S and a molecular weight of 289.28 g/mol. IUPAC name: 10-fluoro-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylic acid. InChIKey: TWHGHPZVTJKFAU-UHFFFAOYSA-N.
| Molecular formula | C14H8FNO3S |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | 10-fluoro-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxylic acid |
| InChIKey | TWHGHPZVTJKFAU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)SC3=C(C=C(C=C3)C(=O)O)NC2=O |
Computed by PubChem (NCBI)