Products 328960-84-5
CAS 328960-84-5 appears in our catalog under these names: POSH-IN-1, 99.71%, POSH-IN-1, 95+%. Offered by: MedChemExpress, Ambeed. Available pack sizes: 25 mg, 5 mg, 10 mg, 100mg, 250mg.
5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (CAS 328960-84-5) is a chemical compound with the molecular formula C14H8FNO3S and a molecular weight of 289.28 g/mol. IUPAC name: 5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: UFBTYTGRUBUUIL-UHFFFAOYSA-N.
| Molecular formula | C14H8FNO3S |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | 5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | UFBTYTGRUBUUIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C=C3C(=O)NC(=O)S3)F |
Computed by PubChem (NCBI)