CAS 1218790-18-1 appears in our catalog under these names: 5-Fluoro-2-(methoxycarbonyl)pyridine-4-boronic acid, pinacol ester, 98%, Methyl 5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
Methyl 5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 1218790-18-1) is a chemical compound with the molecular formula C13H17BFNO4 and a molecular weight of 281.09 g/mol. IUPAC name: methyl 5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: BJMXRGXGJNDFBT-UHFFFAOYSA-N.
| Molecular formula | C13H17BFNO4 |
|---|---|
| Molecular weight | 281.09 g/mol |
| IUPAC name | methyl 5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | BJMXRGXGJNDFBT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2F)C(=O)OC |
Computed by PubChem (NCBI)